Products 1145671-38-0
CAS 1145671-38-0 appears in our catalog under these names: 4-Chloro-7-hydroxyquinazolin-6-yl pivalate, 4-Chloro-7-hydroxyquinazolin-6-yl pivalate, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm. Available pack sizes: 2g, 1g, 5g, 10g, 250mg, 100mg.
(4-chloro-7-hydroxyquinazolin-6-yl) 2,2-dimethylpropanoate (CAS 1145671-38-0) is a chemical compound with the molecular formula C13H13ClN2O3 and a molecular weight of 280.70 g/mol. IUPAC name: (4-chloro-7-hydroxyquinazolin-6-yl) 2,2-dimethylpropanoate. InChIKey: QHCBJLQPMHZHEY-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O3 |
|---|---|
| Molecular weight | 280.70 g/mol |
| IUPAC name | (4-chloro-7-hydroxyquinazolin-6-yl) 2,2-dimethylpropanoate |
| InChIKey | QHCBJLQPMHZHEY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=C(C=C2C(=C1)C(=NC=N2)Cl)O |
Computed by PubChem (NCBI)