Products 1146299-25-3
CAS 1146299-25-3 appears in our catalog under these names: 4,5-Dimethyl-2-(1h-tetrazol-1-yl)thiophene-3-carboxylic acid, 95%, 4,5-dimethyl-2-(1H-1,2,3,4-tetrazol-1-yl)thiophene-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g.
4,5-dimethyl-2-(tetrazol-1-yl)thiophene-3-carboxylic acid (CAS 1146299-25-3) is a chemical compound with the molecular formula C8H8N4O2S and a molecular weight of 224.24 g/mol. IUPAC name: 4,5-dimethyl-2-(tetrazol-1-yl)thiophene-3-carboxylic acid. InChIKey: DRBXCOZZSUUZBK-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O2S |
|---|---|
| Molecular weight | 224.24 g/mol |
| IUPAC name | 4,5-dimethyl-2-(tetrazol-1-yl)thiophene-3-carboxylic acid |
| InChIKey | DRBXCOZZSUUZBK-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)O)N2C=NN=N2)C |
Computed by PubChem (NCBI)