Products 1499649-10-3

CAS 1499649-10-3 is the registry number for 4-Ethyl-2-(4H-1,2,4-triazol-3-yl)-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-ethyl-2-(1H-1,2,4-triazol-5-yl)-1,3-thiazole-5-carboxylic acid (CAS 1499649-10-3) is a chemical compound with the molecular formula C8H8N4O2S and a molecular weight of 224.24 g/mol. IUPAC name: 4-ethyl-2-(1H-1,2,4-triazol-5-yl)-1,3-thiazole-5-carboxylic acid. InChIKey: UWCIZZVMWXOUHA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8N4O2S
Molecular weight224.24 g/mol
IUPAC name4-ethyl-2-(1H-1,2,4-triazol-5-yl)-1,3-thiazole-5-carboxylic acid
InChIKeyUWCIZZVMWXOUHA-UHFFFAOYSA-N
SMILESCCC1=C(SC(=N1)C2=NC=NN2)C(=O)O

Computed by PubChem (NCBI)