CAS 1499649-10-3 is the registry number for 4-Ethyl-2-(4H-1,2,4-triazol-3-yl)-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-ethyl-2-(1H-1,2,4-triazol-5-yl)-1,3-thiazole-5-carboxylic acid (CAS 1499649-10-3) is a chemical compound with the molecular formula C8H8N4O2S and a molecular weight of 224.24 g/mol. IUPAC name: 4-ethyl-2-(1H-1,2,4-triazol-5-yl)-1,3-thiazole-5-carboxylic acid. InChIKey: UWCIZZVMWXOUHA-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O2S |
|---|---|
| Molecular weight | 224.24 g/mol |
| IUPAC name | 4-ethyl-2-(1H-1,2,4-triazol-5-yl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | UWCIZZVMWXOUHA-UHFFFAOYSA-N |
| SMILES | CCC1=C(SC(=N1)C2=NC=NN2)C(=O)O |
Computed by PubChem (NCBI)