CAS 180864-33-9 appears in our catalog under these names: Tyrosinase-IN-2/ 98.21% (existing batch purity), Tyrosinase–IN–2, (E)-2-(4-Nitrobenzylidene)hydrazine-1-carbothioamide, 98%, 98%, Tyrosinase-IN-2, 99.71%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg, 10mM/1mL.
[(E)-(4-nitrophenyl)methylideneamino]thiourea (CAS 180864-33-9) is a chemical compound with the molecular formula C8H8N4O2S and a molecular weight of 224.24 g/mol. IUPAC name: [(E)-(4-nitrophenyl)methylideneamino]thiourea. InChIKey: HSDCBIHJEGDMDO-BJMVGYQFSA-N.
| Molecular formula | C8H8N4O2S |
|---|---|
| Molecular weight | 224.24 g/mol |
| IUPAC name | [(E)-(4-nitrophenyl)methylideneamino]thiourea |
| InChIKey | HSDCBIHJEGDMDO-BJMVGYQFSA-N |
| SMILES | C1=CC(=CC=C1/C=N/NC(=S)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)