CAS 929975-69-9 is the registry number for 2-(3-(Furan-2-yl)-5-sulfanyl-4H-1,2,4-triazol-4-yl)acetamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-[3-(furan-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide (CAS 929975-69-9) is a chemical compound with the molecular formula C8H8N4O2S and a molecular weight of 224.24 g/mol. IUPAC name: 2-[3-(furan-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide. InChIKey: BTYNTRCBSVUZCA-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O2S |
|---|---|
| Molecular weight | 224.24 g/mol |
| IUPAC name | 2-[3-(furan-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
| InChIKey | BTYNTRCBSVUZCA-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NNC(=S)N2CC(=O)N |
Computed by PubChem (NCBI)