CAS 1187975-28-5 is the registry number for 4-Amino-5-(2,4-dihydroxyphenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-3-(2,4-dihydroxyphenyl)-1H-1,2,4-triazole-5-thione (CAS 1187975-28-5) is a chemical compound with the molecular formula C8H8N4O2S and a molecular weight of 224.24 g/mol. IUPAC name: 4-amino-3-(2,4-dihydroxyphenyl)-1H-1,2,4-triazole-5-thione. InChIKey: OGFYNYXFDWHFBW-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O2S |
|---|---|
| Molecular weight | 224.24 g/mol |
| IUPAC name | 4-amino-3-(2,4-dihydroxyphenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | OGFYNYXFDWHFBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)C2=NNC(=S)N2N |
Computed by PubChem (NCBI)