CAS 114741-27-4 is the registry number for N-(2-Oxoindolin-5-yl)acetamide. Offered by: TRC. Available pack sizes: 2,5g.
N-(2-oxo-1,3-dihydroindol-5-yl)acetamide (CAS 114741-27-4) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: N-(2-oxo-1,3-dihydroindol-5-yl)acetamide. InChIKey: GAPFXVWCGZCQPI-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | N-(2-oxo-1,3-dihydroindol-5-yl)acetamide |
| InChIKey | GAPFXVWCGZCQPI-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC2=C(C=C1)NC(=O)C2 |
Computed by PubChem (NCBI)