CAS 1147858-83-0 appears in our catalog under these names: 2,6-Dibromobenzyl acetate, 95%, 2,6-Dibromobenzyl acetate, 98+%, 2,6-Dibromobenzyl Acetate, ≥95%, ≥95%, 2,6-Dibromobenzyl acetate, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 25g, 10g, 100mg, 5g.
(2,6-dibromophenyl)methyl acetate (CAS 1147858-83-0) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: (2,6-dibromophenyl)methyl acetate. InChIKey: OQEMWUROKHRRHO-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | (2,6-dibromophenyl)methyl acetate |
| InChIKey | OQEMWUROKHRRHO-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C=CC=C1Br)Br |
Computed by PubChem (NCBI)