Products 114797-97-6
CAS 114797-97-6 is the registry number for 1-(Pyridin-4-ylmethyl)-1H-benzo[d]imidazol-2(3H)-one, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(pyridin-4-ylmethyl)-1H-benzimidazol-2-one (CAS 114797-97-6) is a chemical compound with the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. IUPAC name: 3-(pyridin-4-ylmethyl)-1H-benzimidazol-2-one. InChIKey: FUFVZFFZGWWOLS-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 3-(pyridin-4-ylmethyl)-1H-benzimidazol-2-one |
| InChIKey | FUFVZFFZGWWOLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)N2CC3=CC=NC=C3 |
Computed by PubChem (NCBI)