CAS 114873-05-1 appears in our catalog under these names: Boc–Phe(2–Me)–OH, Boc-Phe(2-Me)-OH, 97%, 97%, (S)-2-((tert-Butoxycarbonyl)amino)-3-(o-tolyl)propanoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g, 10g.
(2S)-3-(2-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 114873-05-1) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2S)-3-(2-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: PCGOCPOJLMLJAR-LBPRGKRZSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2S)-3-(2-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | PCGOCPOJLMLJAR-LBPRGKRZSA-N |
| SMILES | CC1=CC=CC=C1C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)