CAS 80102-29-0 appears in our catalog under these names: N–Boc–2–methyl–D–phenylalanine, BOC-2-methyl-D-phenylalanine, 98%, 98%, (R)-2-((tert-Butoxycarbonyl)amino)-3-(o-tolyl)propanoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 100g, 1g, 10g, 25g.
(2R)-3-(2-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 80102-29-0) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2R)-3-(2-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: PCGOCPOJLMLJAR-GFCCVEGCSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2R)-3-(2-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | PCGOCPOJLMLJAR-GFCCVEGCSA-N |
| SMILES | CC1=CC=CC=C1C[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)