CAS 1149-24-2 appears in our catalog under these names: Diethyl 2,6–dimethylpyridine–3,5–dicarboxylate, Diethyl 2,6-Dimethylpyridine-3,5-dicarboxylate, >98.0%(GC), Diethyl 2,6-dimethylpyridine-3,5-dicarboxylate 97%, DIETHYL 2,6-DIMETHYLPYRIDINE-3,5-DICARB&, Diethyl 2,6-dimethylpyridine-3,5-dicarboxylate, 97%, 97%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 25g.
Diethyl 2,6-dimethylpyridine-3,5-dicarboxylate (CAS 1149-24-2) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: diethyl 2,6-dimethylpyridine-3,5-dicarboxylate. InChIKey: DIIWSYPKAJVXBV-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | diethyl 2,6-dimethylpyridine-3,5-dicarboxylate |
| InChIKey | DIIWSYPKAJVXBV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(N=C1C)C)C(=O)OCC |
Computed by PubChem (NCBI)