CAS 1150098-39-7 appears in our catalog under these names: 7-Chloro-5-oxo-1,2,3,5-tetrahydroindolizine-8-carboxylic acid, 98%, 7-Chloro-5-oxo-1,2,3,5-tetrahydroindolizine-8-carboxylic acid, 97%, 7-Chloro-5-oxo-1,2,3,5-tetrahydroindolizine-8-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
7-chloro-5-oxo-2,3-dihydro-1H-indolizine-8-carboxylic acid (CAS 1150098-39-7) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. IUPAC name: 7-chloro-5-oxo-2,3-dihydro-1H-indolizine-8-carboxylic acid. InChIKey: BLFBEBOCEPNCRD-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 7-chloro-5-oxo-2,3-dihydro-1H-indolizine-8-carboxylic acid |
| InChIKey | BLFBEBOCEPNCRD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=O)N2C1)Cl)C(=O)O |
Computed by PubChem (NCBI)