Products 13450-77-6
CAS 13450-77-6 appears in our catalog under these names: 2-(4-Chlorobenzamido)acetic acid, 95%, 4-Chlorohippuric Acid, >95% (HPLC), 2–(4–Chlorobenzamido)acetic acid, 4-Chlorohippuric acid, 2-(4-Chlorobenzamido)acetic acid 95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg.
2-[(4-chlorobenzoyl)amino]acetic acid (CAS 13450-77-6) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. IUPAC name: 2-[(4-chlorobenzoyl)amino]acetic acid. InChIKey: COYZIYOEXGRBHQ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 2-[(4-chlorobenzoyl)amino]acetic acid |
| InChIKey | COYZIYOEXGRBHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(=O)O)Cl |
Computed by PubChem (NCBI)