CAS 74114-62-8 appears in our catalog under these names: 4-Acetamido-3-chlorobenzoic acid, 95%, 4-(Acetylamino)-3-chlorobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
4-acetamido-3-chlorobenzoic acid (CAS 74114-62-8) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. IUPAC name: 4-acetamido-3-chlorobenzoic acid. InChIKey: ZFQGFRPIFLLJKF-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 4-acetamido-3-chlorobenzoic acid |
| InChIKey | ZFQGFRPIFLLJKF-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)