CAS 134372-47-7 appears in our catalog under these names: 6-Chloro-3,4-dihydro-2h-benzo[b][1,4]oxazine-8-carboxylic acid, 95%, 6-Chloro-3,4-dihydro-2H-benzo[b][1,4]oxazine-8-carboxylic acid 95%, 6-Chloro-3,4-dihydro-2H-benzo[b][1,4]oxazine-8-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg.
6-chloro-3,4-dihydro-2H-1,4-benzoxazine-8-carboxylic acid (CAS 134372-47-7) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-1,4-benzoxazine-8-carboxylic acid. InChIKey: RDIXXNVIEWPZCD-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-2H-1,4-benzoxazine-8-carboxylic acid |
| InChIKey | RDIXXNVIEWPZCD-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2N1)Cl)C(=O)O |
Computed by PubChem (NCBI)