CAS 66497-44-7 appears in our catalog under these names: 5-Methylfuro[3,2-b]pyridine-2-carboxylic acid hydrochloride, 95%, 5–Methylfuro(3,2–b)pyridine–2–carboxylic acid hydrochloride, 5-methylfuro(3,2-b)pyridine-2-carboxylic Acid hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 50mg, 0,5g.
5-methylfuro[3,2-b]pyridine-2-carboxylic acid;hydrochloride (CAS 66497-44-7) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. IUPAC name: 5-methylfuro[3,2-b]pyridine-2-carboxylic acid;hydrochloride. InChIKey: LADTXKMLMKDJSO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 5-methylfuro[3,2-b]pyridine-2-carboxylic acid;hydrochloride |
| InChIKey | LADTXKMLMKDJSO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)OC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)