CAS 1154372-57-2 appears in our catalog under these names: 1-(2-Chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxylic acid, 95%, 1-(2-Chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(2-chlorophenyl)-5-cyclopropyl-1,2,4-triazole-3-carboxylic acid (CAS 1154372-57-2) is a chemical compound with the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. IUPAC name: 1-(2-chlorophenyl)-5-cyclopropyl-1,2,4-triazole-3-carboxylic acid. InChIKey: JJRBRDQMNYQRHA-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O2 |
|---|---|
| Molecular weight | 263.68 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-5-cyclopropyl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | JJRBRDQMNYQRHA-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC(=NN2C3=CC=CC=C3Cl)C(=O)O |
Computed by PubChem (NCBI)