CAS 1150313-15-7 is the registry number for Neocryptolepine-Cl. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-chloro-5-methylindolo[2,3-b]quinoline (CAS 1150313-15-7) is a chemical compound with the molecular formula C16H11ClN2 and a molecular weight of 266.72 g/mol. IUPAC name: 8-chloro-5-methylindolo[2,3-b]quinoline. InChIKey: SLMPVQJBJPEFAZ-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN2 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | 8-chloro-5-methylindolo[2,3-b]quinoline |
| InChIKey | SLMPVQJBJPEFAZ-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C=C3C1=NC4=C3C=CC(=C4)Cl |
Computed by PubChem (NCBI)