CAS 1214357-62-6 is the registry number for 3-(3-Chloro-5-(pyridin-4-yl)phenyl)pyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-chloro-5-pyridin-4-ylphenyl)pyridine (CAS 1214357-62-6) is a chemical compound with the molecular formula C16H11ClN2 and a molecular weight of 266.72 g/mol. IUPAC name: 3-(3-chloro-5-pyridin-4-ylphenyl)pyridine. InChIKey: HSMRTECXUWKZLE-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN2 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | 3-(3-chloro-5-pyridin-4-ylphenyl)pyridine |
| InChIKey | HSMRTECXUWKZLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC(=CC(=C2)C3=CC=NC=C3)Cl |
Computed by PubChem (NCBI)