CAS 41270-66-0 appears in our catalog under these names: Selexipag Impurity 11, 5–Chloro–2,3–diphenylpyrazine, 2-Chloro-5,6-diphenylpyrazine, 5-Chloro-2,3-diphenylpyrazine, >98.0%(GC), 5-Chloro-2,3-diphenylpyrazine 98%. Offered by: Chemat Brand, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: on request, 100g, 25g, 5g, 50g, 1g, 250mg, 500g.
5-chloro-2,3-diphenylpyrazine (CAS 41270-66-0) is a chemical compound with the molecular formula C16H11ClN2 and a molecular weight of 266.72 g/mol. IUPAC name: 5-chloro-2,3-diphenylpyrazine. InChIKey: VUGNCPVAXWZTOL-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN2 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | 5-chloro-2,3-diphenylpyrazine |
| InChIKey | VUGNCPVAXWZTOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(N=C2C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)