CAS 94477-36-8 is the registry number for 3-Chloro-4,6-diphenylpyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-4,6-diphenylpyridazine (CAS 94477-36-8) is a chemical compound with the molecular formula C16H11ClN2 and a molecular weight of 266.72 g/mol. IUPAC name: 3-chloro-4,6-diphenylpyridazine. InChIKey: LLNKQEGLWGATPC-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN2 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | 3-chloro-4,6-diphenylpyridazine |
| InChIKey | LLNKQEGLWGATPC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NN=C2Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)