CAS 439929-26-7 is the registry number for 4-Chloro-6-phenyl-2,4'-bipyridine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-2-phenyl-6-pyridin-4-ylpyridine (CAS 439929-26-7) is a chemical compound with the molecular formula C16H11ClN2 and a molecular weight of 266.72 g/mol. IUPAC name: 4-chloro-2-phenyl-6-pyridin-4-ylpyridine. InChIKey: GUBOYIJUFFCQRS-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN2 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | 4-chloro-2-phenyl-6-pyridin-4-ylpyridine |
| InChIKey | GUBOYIJUFFCQRS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC(=C2)Cl)C3=CC=NC=C3 |
Computed by PubChem (NCBI)