CAS 115101-93-4 appears in our catalog under these names: (1,1':4',1'–Terphenyl)–2',4,4',5'–tetracarboxylic acid, [1,1':4',1''-Terphenyl]-2',4,4'',5'-tetracarboxylic acid, 98%, 98%, (1,1':4',1"-Terphenyl)-2',4,4",5'-tetracarboxylic acid, 98%, [1,1':4',1''-Terphenyl]-2',4,4'',5'-tetracarboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
2,5-bis(4-carboxyphenyl)terephthalic acid (CAS 115101-93-4) is a chemical compound with the molecular formula C22H14O8 and a molecular weight of 406.3 g/mol. IUPAC name: 2,5-bis(4-carboxyphenyl)terephthalic acid. InChIKey: AMSDUJSGRUNTLC-UHFFFAOYSA-N.
| Molecular formula | C22H14O8 |
|---|---|
| Molecular weight | 406.3 g/mol |
| IUPAC name | 2,5-bis(4-carboxyphenyl)terephthalic acid |
| InChIKey | AMSDUJSGRUNTLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2C(=O)O)C3=CC=C(C=C3)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)