Products 1580004-08-5
CAS 1580004-08-5 is the registry number for [1,1':4',1''-Terphenyl]-2,2'',4,4''-tetracarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.
4-[4-(2,4-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid (CAS 1580004-08-5) is a chemical compound with the molecular formula C22H14O8 and a molecular weight of 406.3 g/mol. IUPAC name: 4-[4-(2,4-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid. InChIKey: XUZLDIYRUFBGQU-UHFFFAOYSA-N.
| Molecular formula | C22H14O8 |
|---|---|
| Molecular weight | 406.3 g/mol |
| IUPAC name | 4-[4-(2,4-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | XUZLDIYRUFBGQU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)C(=O)O)C(=O)O)C3=C(C=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)