CAS 1810737-66-6 appears in our catalog under these names: [1,1':3',1''-Terphenyl]-4,4',4'',6'-tetracarboxylic acid, 97%, 97%, [1,1':3',1''-Terphenyl]-4,4',4'',6'-tetracarboxylic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4,6-bis(4-carboxyphenyl)benzene-1,3-dicarboxylic acid (CAS 1810737-66-6) is a chemical compound with the molecular formula C22H14O8 and a molecular weight of 406.3 g/mol. IUPAC name: 4,6-bis(4-carboxyphenyl)benzene-1,3-dicarboxylic acid. InChIKey: XUMDIWKMZRYISQ-UHFFFAOYSA-N.
| Molecular formula | C22H14O8 |
|---|---|
| Molecular weight | 406.3 g/mol |
| IUPAC name | 4,6-bis(4-carboxyphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | XUMDIWKMZRYISQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2C(=O)O)C(=O)O)C3=CC=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)