Products 1433189-27-5
CAS 1433189-27-5 appears in our catalog under these names: (1,1'：3',1''–terphenyl)–3,3'',5,5''–tetracarboxylic acid, [1,1:3,1-Terphenyl]-3,3,5,5-tetracarboxylic acid, 95%, 95%, [1,1':3',1''-terphenyl]-3,3'',5,5''-tetracarboxylic acid, 95%, [1,1:3,1-Terphenyl]-3,3,5,5-tetracarboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 500mg, 100mg, 250mg, 5g, 10g.
5-[3-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid (CAS 1433189-27-5) is a chemical compound with the molecular formula C22H14O8 and a molecular weight of 406.3 g/mol. IUPAC name: 5-[3-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid. InChIKey: TZOSCSXHFPKRBH-UHFFFAOYSA-N.
| Molecular formula | C22H14O8 |
|---|---|
| Molecular weight | 406.3 g/mol |
| IUPAC name | 5-[3-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | TZOSCSXHFPKRBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC(=C2)C(=O)O)C(=O)O)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)