CAS 1648735-35-6 is the registry number for [1,1':4',1''-Terphenyl]-2',3,3'',5'-tetracarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-bis(3-carboxyphenyl)terephthalic acid (CAS 1648735-35-6) is a chemical compound with the molecular formula C22H14O8 and a molecular weight of 406.3 g/mol. IUPAC name: 2,5-bis(3-carboxyphenyl)terephthalic acid. InChIKey: DJAKWWGGZZAMCK-UHFFFAOYSA-N.
| Molecular formula | C22H14O8 |
|---|---|
| Molecular weight | 406.3 g/mol |
| IUPAC name | 2,5-bis(3-carboxyphenyl)terephthalic acid |
| InChIKey | DJAKWWGGZZAMCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=C(C=C2C(=O)O)C3=CC(=CC=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)