CAS 1152-14-3 appears in our catalog under these names: Resorufin acetate, 95%, Resorufin acetate, 95+%, Resorufin Acetate, Resorufin acetate, Resorufin acetate, 98.04%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 10mg, 25mg, 5mg, 50mg, 10 mg.
(7-oxophenoxazin-3-yl) acetate (CAS 1152-14-3) is a chemical compound with the molecular formula C14H9NO4 and a molecular weight of 255.22 g/mol. IUPAC name: (7-oxophenoxazin-3-yl) acetate. InChIKey: UJWKHDKBOVPINX-UHFFFAOYSA-N.
| Molecular formula | C14H9NO4 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | (7-oxophenoxazin-3-yl) acetate |
| InChIKey | UJWKHDKBOVPINX-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)N=C3C=CC(=O)C=C3O2 |
Computed by PubChem (NCBI)