CAS 2289758-94-5 is the registry number for 4'-Nitro-[1,1'-biphenyl]-3,5-dicarbaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-nitrophenyl)benzene-1,3-dicarbaldehyde (CAS 2289758-94-5) is a chemical compound with the molecular formula C14H9NO4 and a molecular weight of 255.22 g/mol. IUPAC name: 5-(4-nitrophenyl)benzene-1,3-dicarbaldehyde. InChIKey: CKSAVDZXZLOKJY-UHFFFAOYSA-N.
| Molecular formula | C14H9NO4 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 5-(4-nitrophenyl)benzene-1,3-dicarbaldehyde |
| InChIKey | CKSAVDZXZLOKJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C=O)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)