CAS 2270908-49-9 is the registry number for 7,8-Dihydroxy-4-pyridin-4-yl-chromen-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
7,8-dihydroxy-4-pyridin-4-ylchromen-2-one (CAS 2270908-49-9) is a chemical compound with the molecular formula C14H9NO4 and a molecular weight of 255.22 g/mol. IUPAC name: 7,8-dihydroxy-4-pyridin-4-ylchromen-2-one. InChIKey: HXAJSJYICFHSBU-UHFFFAOYSA-N.
| Molecular formula | C14H9NO4 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 7,8-dihydroxy-4-pyridin-4-ylchromen-2-one |
| InChIKey | HXAJSJYICFHSBU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=CC(=O)O2)C3=CC=NC=C3)O)O |
Computed by PubChem (NCBI)