CAS 3963-78-8 appears in our catalog under these names: 3-Amino-1,2-dihydroxyanthracene-9,10-dione, 98%, 3-Amino-1,2-dihydroxyanthracene-9,10-dione, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
3-amino-1,2-dihydroxyanthracene-9,10-dione (CAS 3963-78-8) is a chemical compound with the molecular formula C14H9NO4 and a molecular weight of 255.22 g/mol. IUPAC name: 3-amino-1,2-dihydroxyanthracene-9,10-dione. InChIKey: YLFWHISGXDKCIT-UHFFFAOYSA-N.
| Molecular formula | C14H9NO4 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 3-amino-1,2-dihydroxyanthracene-9,10-dione |
| InChIKey | YLFWHISGXDKCIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)N |
Computed by PubChem (NCBI)