CAS 173846-17-8 appears in our catalog under these names: 1-(7-Nitrodibenzo[b,d]furan-2-yl)ethanone, 95%, 1-(7-Nitrodibenzo(b,d)furan-2-yl)ethanone, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(7-nitrodibenzofuran-2-yl)ethanone (CAS 173846-17-8) is a chemical compound with the molecular formula C14H9NO4 and a molecular weight of 255.22 g/mol. IUPAC name: 1-(7-nitrodibenzofuran-2-yl)ethanone. InChIKey: VHNWACCPZKFEBW-UHFFFAOYSA-N.
| Molecular formula | C14H9NO4 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 1-(7-nitrodibenzofuran-2-yl)ethanone |
| InChIKey | VHNWACCPZKFEBW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)OC3=C2C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)