CAS 1152029-16-7 is the registry number for (αR)-α-[(1S)-1-Aminoethyl]-3,5-bis(trifluoromethyl)benzenemethanol, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 5g.
(1R,2S)-2-amino-1-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol (CAS 1152029-16-7) is a chemical compound with the molecular formula C11H11F6NO and a molecular weight of 287.20 g/mol. IUPAC name: (1R,2S)-2-amino-1-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol. InChIKey: DXIHDYCFZWJHIQ-CDUCUWFYSA-N.
| Molecular formula | C11H11F6NO |
|---|---|
| Molecular weight | 287.20 g/mol |
| IUPAC name | (1R,2S)-2-amino-1-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol |
| InChIKey | DXIHDYCFZWJHIQ-CDUCUWFYSA-N |
| SMILES | C[C@@H]([C@@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O)N |
Computed by PubChem (NCBI)