CAS 1336255-95-8 is the registry number for (R)-2-(3,5-Bis(trifluoromethyl)phenyl)-2-(methylamino)ethanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[3,5-bis(trifluoromethyl)phenyl]-2-(methylamino)ethanol (CAS 1336255-95-8) is a chemical compound with the molecular formula C11H11F6NO and a molecular weight of 287.20 g/mol. IUPAC name: (2R)-2-[3,5-bis(trifluoromethyl)phenyl]-2-(methylamino)ethanol. InChIKey: OPOGTKGXHOEJIB-VIFPVBQESA-N.
| Molecular formula | C11H11F6NO |
|---|---|
| Molecular weight | 287.20 g/mol |
| IUPAC name | (2R)-2-[3,5-bis(trifluoromethyl)phenyl]-2-(methylamino)ethanol |
| InChIKey | OPOGTKGXHOEJIB-VIFPVBQESA-N |
| SMILES | CN[C@@H](CO)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)