CAS 875444-02-3 is the registry number for 2-Amino-1-(3,5-bis(trifluoromethyl)phenyl)propan-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-amino-1-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol (CAS 875444-02-3) is a chemical compound with the molecular formula C11H11F6NO and a molecular weight of 287.20 g/mol. IUPAC name: 2-amino-1-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol. InChIKey: DXIHDYCFZWJHIQ-UHFFFAOYSA-N.
| Molecular formula | C11H11F6NO |
|---|---|
| Molecular weight | 287.20 g/mol |
| IUPAC name | 2-amino-1-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol |
| InChIKey | DXIHDYCFZWJHIQ-UHFFFAOYSA-N |
| SMILES | CC(C(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O)N |
Computed by PubChem (NCBI)