CAS 637347-78-5 is the registry number for 2-(4-Amino-3-ethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-amino-3-ethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (CAS 637347-78-5) is a chemical compound with the molecular formula C11H11F6NO and a molecular weight of 287.20 g/mol. IUPAC name: 2-(4-amino-3-ethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol. InChIKey: SMFWQOQBCWAPNA-UHFFFAOYSA-N.
| Molecular formula | C11H11F6NO |
|---|---|
| Molecular weight | 287.20 g/mol |
| IUPAC name | 2-(4-amino-3-ethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChIKey | SMFWQOQBCWAPNA-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)C(C(F)(F)F)(C(F)(F)F)O)N |
Computed by PubChem (NCBI)