CAS 65797-85-5 appears in our catalog under these names: 2-(4-(Ethylamino)phenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 95%, 2-(4-(Ethylamino)phenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-[4-(ethylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (CAS 65797-85-5) is a chemical compound with the molecular formula C11H11F6NO and a molecular weight of 287.20 g/mol. IUPAC name: 2-[4-(ethylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol. InChIKey: USWYBKLKNAFHAX-UHFFFAOYSA-N.
| Molecular formula | C11H11F6NO |
|---|---|
| Molecular weight | 287.20 g/mol |
| IUPAC name | 2-[4-(ethylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChIKey | USWYBKLKNAFHAX-UHFFFAOYSA-N |
| SMILES | CCNC1=CC=C(C=C1)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)