Products 115228-29-0

CAS 115228-29-0 is the registry number for (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl octanoate, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(2,2-dimethyl-1,3-dioxolan-4-yl)methyl octanoate (CAS 115228-29-0) is a chemical compound with the molecular formula C14H26O4 and a molecular weight of 258.35 g/mol. IUPAC name: (2,2-dimethyl-1,3-dioxolan-4-yl)methyl octanoate. InChIKey: GLKYAJSVVULZFA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H26O4
Molecular weight258.35 g/mol
IUPAC name(2,2-dimethyl-1,3-dioxolan-4-yl)methyl octanoate
InChIKeyGLKYAJSVVULZFA-UHFFFAOYSA-N
SMILESCCCCCCCC(=O)OCC1COC(O1)(C)C

Computed by PubChem (NCBI)