CAS 1152493-38-3 is the registry number for 3-Benzamidophenyl dimethylcarbamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
(3-benzamidophenyl) N,N-dimethylcarbamate (CAS 1152493-38-3) is a chemical compound with the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. IUPAC name: (3-benzamidophenyl) N,N-dimethylcarbamate. InChIKey: IPOBPVFYCWSHQA-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | (3-benzamidophenyl) N,N-dimethylcarbamate |
| InChIKey | IPOBPVFYCWSHQA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)OC1=CC=CC(=C1)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)