CAS 1152515-60-0 appears in our catalog under these names: (1-(2,4-Dichlorophenyl)ethyl)thiourea, 95%, (1-(2,4-Dichlorophenyl)ethyl)thiourea. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
1-(2,4-dichlorophenyl)ethylthiourea (CAS 1152515-60-0) is a chemical compound with the molecular formula C9H10Cl2N2S and a molecular weight of 249.16 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)ethylthiourea. InChIKey: TZOJBQPAHVWAOP-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2S |
|---|---|
| Molecular weight | 249.16 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)ethylthiourea |
| InChIKey | TZOJBQPAHVWAOP-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)Cl)Cl)NC(=S)N |
Computed by PubChem (NCBI)