CAS 1181458-86-5 appears in our catalog under these names: 4-(1,3-Thiazol-2-yl)aniline dihydrochloride, 4-(1,3-Thiazol-2-yl)aniline dihydrochloride 95%, 4-(1,3-Thiazol-2-yl)aniline dihydrochloride, 95%, 95%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 0,5g, 250mg, 1g.
4-(1,3-thiazol-2-yl)aniline;dihydrochloride (CAS 1181458-86-5) is a chemical compound with the molecular formula C9H10Cl2N2S and a molecular weight of 249.16 g/mol. IUPAC name: 4-(1,3-thiazol-2-yl)aniline;dihydrochloride. InChIKey: PPEQPJMBQLMDGB-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2S |
|---|---|
| Molecular weight | 249.16 g/mol |
| IUPAC name | 4-(1,3-thiazol-2-yl)aniline;dihydrochloride |
| InChIKey | PPEQPJMBQLMDGB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=CS2)N.Cl.Cl |
Computed by PubChem (NCBI)