CAS 1440535-56-7 is the registry number for N-(2,4-Dichloro-6-methylphenyl)-n'-methylthiourea, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(2,4-dichloro-6-methylphenyl)-3-methylthiourea (CAS 1440535-56-7) is a chemical compound with the molecular formula C9H10Cl2N2S and a molecular weight of 249.16 g/mol. IUPAC name: 1-(2,4-dichloro-6-methylphenyl)-3-methylthiourea. InChIKey: MOXUINHAGBZJNE-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2S |
|---|---|
| Molecular weight | 249.16 g/mol |
| IUPAC name | 1-(2,4-dichloro-6-methylphenyl)-3-methylthiourea |
| InChIKey | MOXUINHAGBZJNE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=S)NC)Cl)Cl |
Computed by PubChem (NCBI)