CAS 210428-41-4 appears in our catalog under these names: 2-(5-Chloro-1,3-benzothiazol-2-yl)ethan-1-amine hydrochloride, 95%, 2-(5-Chloro-1,3-benzothiazol-2-yl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride (CAS 210428-41-4) is a chemical compound with the molecular formula C9H10Cl2N2S and a molecular weight of 249.16 g/mol. IUPAC name: 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride. InChIKey: JJPBWCIHXKXTKF-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2S |
|---|---|
| Molecular weight | 249.16 g/mol |
| IUPAC name | 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride |
| InChIKey | JJPBWCIHXKXTKF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=C(S2)CCN.Cl |
Computed by PubChem (NCBI)