CAS 75366-03-9 is the registry number for 2-(3,4-Dichlorophenethyl)isothiourea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
2-(3,4-dichlorophenyl)ethyl carbamimidothioate (CAS 75366-03-9) is a chemical compound with the molecular formula C9H10Cl2N2S and a molecular weight of 249.16 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)ethyl carbamimidothioate. InChIKey: BXGBLZPKBJAYTH-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2S |
|---|---|
| Molecular weight | 249.16 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)ethyl carbamimidothioate |
| InChIKey | BXGBLZPKBJAYTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCSC(=N)N)Cl)Cl |
Computed by PubChem (NCBI)