CAS 1152535-85-7 appears in our catalog under these names: 1-(2,4-Dimethylphenyl)-1H,4H,5H,6H-cyclopenta(c)pyrazole-3-carboxylic acid, 95%, 1-(2,4-Dimethylphenyl)-1H,4H,5H,6H-cyclopenta(C)pyrazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(2,4-dimethylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid (CAS 1152535-85-7) is a chemical compound with the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid. InChIKey: NPKVHGWVRWFRLY-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid |
| InChIKey | NPKVHGWVRWFRLY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C3=C(CCC3)C(=N2)C(=O)O)C |
Computed by PubChem (NCBI)