Products 1152543-70-8

CAS 1152543-70-8 is the registry number for 5-(3-(Trifluoromethyl)phenyl)-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-[3-(trifluoromethyl)phenyl]-1H-pyrazole-4-carboxylic acid (CAS 1152543-70-8) is a chemical compound with the molecular formula C11H7F3N2O2 and a molecular weight of 256.18 g/mol. IUPAC name: 5-[3-(trifluoromethyl)phenyl]-1H-pyrazole-4-carboxylic acid. InChIKey: ZRSVORVQSKWLLB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7F3N2O2
Molecular weight256.18 g/mol
IUPAC name5-[3-(trifluoromethyl)phenyl]-1H-pyrazole-4-carboxylic acid
InChIKeyZRSVORVQSKWLLB-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(F)(F)F)C2=C(C=NN2)C(=O)O

Computed by PubChem (NCBI)