CAS 1152588-11-8 appears in our catalog under these names: 1-N-(2,2,2-Trifluoroethyl)benzene-1,3-diamine, 95%, 1-N-(2,2,2-Trifluoroethyl)benzene-1,3-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine (CAS 1152588-11-8) is a chemical compound with the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. IUPAC name: 3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine. InChIKey: AWZXCDPZJIKNJD-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine |
| InChIKey | AWZXCDPZJIKNJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NCC(F)(F)F)N |
Computed by PubChem (NCBI)