Products 1152589-92-8

CAS 1152589-92-8 appears in our catalog under these names: 2-Chloro-5-propanoylbenzene-1-sulfonyl chloride, 95%, 2-Chloro-5-propanoylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.

2-chloro-5-propanoylbenzenesulfonyl chloride (CAS 1152589-92-8) is a chemical compound with the molecular formula C9H8Cl2O3S and a molecular weight of 267.13 g/mol. IUPAC name: 2-chloro-5-propanoylbenzenesulfonyl chloride. InChIKey: UQVSAACJSZOWHH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Cl2O3S
Molecular weight267.13 g/mol
IUPAC name2-chloro-5-propanoylbenzenesulfonyl chloride
InChIKeyUQVSAACJSZOWHH-UHFFFAOYSA-N
SMILESCCC(=O)C1=CC(=C(C=C1)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)