CAS 1334146-20-1 appears in our catalog under these names: 7-Chloro-2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl chloride, 95%, 7-Chloro-2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
7-chloro-2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl chloride (CAS 1334146-20-1) is a chemical compound with the molecular formula C9H8Cl2O3S and a molecular weight of 267.13 g/mol. IUPAC name: 7-chloro-2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl chloride. InChIKey: WKYMHGPTTUKYDH-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3S |
|---|---|
| Molecular weight | 267.13 g/mol |
| IUPAC name | 7-chloro-2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl chloride |
| InChIKey | WKYMHGPTTUKYDH-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(O1)C(=CC(=C2)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)